cas: 811842-36-1 — see every product listed under this CAS number, including other names
3'-Methoxybiphenyl-3-ylamine hydrochloride (CAS 811842-36-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014342-250MG |
| cas | 811842-36-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 253.05 Pln | |
| Fluorochem | 1g | 570.65 Pln | |
| Fluorochem | 5g | 1903.51 Pln |
| delivery time | 3-4 weeks |
|---|
3-(3-methoxyphenyl)aniline;hydrochloride (CAS 811842-36-1) is a chemical compound with the molecular formula C13H14ClNO and a molecular weight of 235.71 g/mol. IUPAC name: 3-(3-methoxyphenyl)aniline;hydrochloride. InChIKey: DXSJOFVGCVBEEK-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO |
|---|---|
| Molecular weight | 235.71 g/mol |
| IUPAC name | 3-(3-methoxyphenyl)aniline;hydrochloride |
| InChIKey | DXSJOFVGCVBEEK-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=CC(=CC=C2)N.Cl |
Computed by PubChem (NCBI)