cas: 57824-30-3 — see every product listed under this CAS number, including other names
3,4-Diamino-N,N-dimethylbenzenesulfonamide, 95%, 95% (CAS 57824-30-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ESMV-100mg |
| cas | 57824-30-3 |
| size | 100mg |
| availability | 1.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 400.40 Pln | |
| Chemat | 250mg | 525.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3,4-diamino-N,N-dimethylbenzenesulfonamide (CAS 57824-30-3) is a chemical compound with the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. IUPAC name: 3,4-diamino-N,N-dimethylbenzenesulfonamide. InChIKey: PNUAACMLJDDJGX-UHFFFAOYSA-N.
| Molecular formula | C8H13N3O2S |
|---|---|
| Molecular weight | 215.28 g/mol |
| IUPAC name | 3,4-diamino-N,N-dimethylbenzenesulfonamide |
| InChIKey | PNUAACMLJDDJGX-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC(=C(C=C1)N)N |
Computed by PubChem (NCBI)