CAS 28795-33-7 appears in our catalog under these names: Tinidazole Impurity 3, Tinidazole Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2-ethylsulfanylethyl)-2-methyl-5-nitroimidazole (CAS 28795-33-7) is a chemical compound with the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. IUPAC name: 1-(2-ethylsulfanylethyl)-2-methyl-5-nitroimidazole. InChIKey: MFRJPLQSIRTHSZ-UHFFFAOYSA-N.
| Molecular formula | C8H13N3O2S |
|---|---|
| Molecular weight | 215.28 g/mol |
| IUPAC name | 1-(2-ethylsulfanylethyl)-2-methyl-5-nitroimidazole |
| InChIKey | MFRJPLQSIRTHSZ-UHFFFAOYSA-N |
| SMILES | CCSCCN1C(=NC=C1[N+](=O)[O-])C |
Computed by PubChem (NCBI)