Products 28795-33-7

CAS 28795-33-7 appears in our catalog under these names: Tinidazole Impurity 3, Tinidazole Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.

1-(2-ethylsulfanylethyl)-2-methyl-5-nitroimidazole (CAS 28795-33-7) is a chemical compound with the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. IUPAC name: 1-(2-ethylsulfanylethyl)-2-methyl-5-nitroimidazole. InChIKey: MFRJPLQSIRTHSZ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13N3O2S
Molecular weight215.28 g/mol
IUPAC name1-(2-ethylsulfanylethyl)-2-methyl-5-nitroimidazole
InChIKeyMFRJPLQSIRTHSZ-UHFFFAOYSA-N
SMILESCCSCCN1C(=NC=C1[N+](=O)[O-])C

Computed by PubChem (NCBI)