CAS 40943-30-4 appears in our catalog under these names: 3-(tert-Butyl)-6-(methylthio)-1,3,5-triazine-2,4(1H,3H)-dione, 98%, Triazine Related Compound 2. Offered by: Chemat Brand. Available pack sizes: on request.
3-tert-butyl-6-methylsulfanyl-1H-1,3,5-triazine-2,4-dione (CAS 40943-30-4) is a chemical compound with the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. IUPAC name: 3-tert-butyl-6-methylsulfanyl-1H-1,3,5-triazine-2,4-dione. InChIKey: FWRITIJOCHMKJX-UHFFFAOYSA-N.
| Molecular formula | C8H13N3O2S |
|---|---|
| Molecular weight | 215.28 g/mol |
| IUPAC name | 3-tert-butyl-6-methylsulfanyl-1H-1,3,5-triazine-2,4-dione |
| InChIKey | FWRITIJOCHMKJX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C(=O)NC(=NC1=O)SC |
Computed by PubChem (NCBI)