CAS 57947-00-9 appears in our catalog under these names: N'-(3-Aminophenyl)-n,n-dimethylsulfamide, 95%, N'-(3-Aminophenyl)-N,N-dimethyl-sulfamide, 95%, N'–(3–Aminophenyl)–N,N–dimethyl–sulfamide. Offered by: Combi-blocks, AmBeed, GLPBio, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
1-amino-3-(dimethylsulfamoylamino)benzene (CAS 57947-00-9) is a chemical compound with the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. IUPAC name: 1-amino-3-(dimethylsulfamoylamino)benzene. InChIKey: VGFFBNNZWLMHDF-UHFFFAOYSA-N.
| Molecular formula | C8H13N3O2S |
|---|---|
| Molecular weight | 215.28 g/mol |
| IUPAC name | 1-amino-3-(dimethylsulfamoylamino)benzene |
| InChIKey | VGFFBNNZWLMHDF-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)NC1=CC=CC(=C1)N |
Computed by PubChem (NCBI)