CAS 1462289-23-1 appears in our catalog under these names: 4-(4-Amino-1h-pyrazol-1-yl)tetrahydro-2h-thiopyran 1,1-dioxide, 95%, 4-(4-Amino-1H-pyrazol-1-yl)tetrahydro-2H-thiopyran 1,1-dioxide, 98%, 1-(Tetrahydro-1,1-dioxido-2H-thiopyran-4-yl)-1H-pyrazol-4-amine, 4-(4-Amino-1H-pyrazol-1-yl)tetrahydro-2H-thiopyran 1,1-dioxide. Offered by: Combi-blocks, AmBeed, TRC, Biosynth. Available pack sizes: 5g, 250mg, 1g, 0,5g, 50mg.
1-(1,1-dioxothian-4-yl)pyrazol-4-amine (CAS 1462289-23-1) is a chemical compound with the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. IUPAC name: 1-(1,1-dioxothian-4-yl)pyrazol-4-amine. InChIKey: YXIRDEKWTZAIKV-UHFFFAOYSA-N.
| Molecular formula | C8H13N3O2S |
|---|---|
| Molecular weight | 215.28 g/mol |
| IUPAC name | 1-(1,1-dioxothian-4-yl)pyrazol-4-amine |
| InChIKey | YXIRDEKWTZAIKV-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC1N2C=C(C=N2)N |
Computed by PubChem (NCBI)