CAS 27280-97-3 appears in our catalog under these names: 1-(1,1-Dioxidotetrahydrothien-3-yl)-3-methyl-1H-pyrazol-5-amine, 1-(1,1-Dioxidotetrahydrothien-3-yl)-3-methyl-1h-pyrazol-5-amine, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 2,5g, 250mg, 5g, 1g.
2-(1,1-dioxothiolan-3-yl)-5-methylpyrazol-3-amine (CAS 27280-97-3) is a chemical compound with the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. IUPAC name: 2-(1,1-dioxothiolan-3-yl)-5-methylpyrazol-3-amine. InChIKey: JAHOJHPUWJXETC-UHFFFAOYSA-N.
| Molecular formula | C8H13N3O2S |
|---|---|
| Molecular weight | 215.28 g/mol |
| IUPAC name | 2-(1,1-dioxothiolan-3-yl)-5-methylpyrazol-3-amine |
| InChIKey | JAHOJHPUWJXETC-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)N)C2CCS(=O)(=O)C2 |
Computed by PubChem (NCBI)