CAS 1853052-18-2 is the registry number for 3-(4-((Methylamino)methyl)-1H-imidazol-1-yl)thietane 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[1-(1,1-dioxothietan-3-yl)imidazol-4-yl]-N-methylmethanamine (CAS 1853052-18-2) is a chemical compound with the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. IUPAC name: 1-[1-(1,1-dioxothietan-3-yl)imidazol-4-yl]-N-methylmethanamine. InChIKey: FHEAZFQAYBVGPU-UHFFFAOYSA-N.
| Molecular formula | C8H13N3O2S |
|---|---|
| Molecular weight | 215.28 g/mol |
| IUPAC name | 1-[1-(1,1-dioxothietan-3-yl)imidazol-4-yl]-N-methylmethanamine |
| InChIKey | FHEAZFQAYBVGPU-UHFFFAOYSA-N |
| SMILES | CNCC1=CN(C=N1)C2CS(=O)(=O)C2 |
Computed by PubChem (NCBI)