CAS 1692539-76-6 is the registry number for 2-(BOC-Amino)-5-methyl-1,3,4-thiadiazole, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Tert-butyl N-(5-methyl-1,3,4-thiadiazol-2-yl)carbamate (CAS 1692539-76-6) is a chemical compound with the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. IUPAC name: tert-butyl N-(5-methyl-1,3,4-thiadiazol-2-yl)carbamate. InChIKey: YKKXAVGKVIJBBX-UHFFFAOYSA-N.
| Molecular formula | C8H13N3O2S |
|---|---|
| Molecular weight | 215.28 g/mol |
| IUPAC name | tert-butyl N-(5-methyl-1,3,4-thiadiazol-2-yl)carbamate |
| InChIKey | YKKXAVGKVIJBBX-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(S1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)