cas: 1025720-99-3 — see every product listed under this CAS number, including other names
3,4-Dichloropicolinamide, 98% (CAS 1025720-99-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A427264-1g |
| cas | 1025720-99-3 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 4828.81 Pln | |
| AmBeed | 5g | 14033.95 Pln | |
| Fluorochem | 100mg | 752.88 Pln | |
| Fluorochem | 250mg | 1237.08 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
3,4-dichloropyridine-2-carboxamide (CAS 1025720-99-3) is a chemical compound with the molecular formula C6H4Cl2N2O and a molecular weight of 191.01 g/mol. IUPAC name: 3,4-dichloropyridine-2-carboxamide. InChIKey: QEYCCTFCRIPTDO-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N2O |
|---|---|
| Molecular weight | 191.01 g/mol |
| IUPAC name | 3,4-dichloropyridine-2-carboxamide |
| InChIKey | QEYCCTFCRIPTDO-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1Cl)Cl)C(=O)N |
Computed by PubChem (NCBI)