cas: 851202-96-5 — see every product listed under this CAS number, including other names
3,4-Dihydro-2H-benzo(b)(1,4)oxazine-7-carboxylic acid, 98% (CAS 851202-96-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A716636-5g |
| cas | 851202-96-5 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 7556.50 Pln | |
| AmBeed | 10g | 12660.34 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid (CAS 851202-96-5) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid. InChIKey: YCTDKGFOTACSHZ-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid |
| InChIKey | YCTDKGFOTACSHZ-UHFFFAOYSA-N |
| SMILES | C1COC2=C(N1)C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)