cas: 851202-96-5 — see every product listed under this CAS number, including other names
3,4-Dihydro-2H-benzo[b][1,4]oxazine-7-carboxylic acid, 98% (CAS 851202-96-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F243247-100MG |
| cas | 851202-96-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 419.66 Pln | |
| Fluorochem | 250mg | 581.06 Pln | |
| Fluorochem | 500mg | 607.10 Pln | |
| Fluorochem | 1g | 721.64 Pln | |
| Fluorochem | 5g | 778.91 Pln | |
| Fluorochem | 10g | 799.74 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid (CAS 851202-96-5) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid. InChIKey: YCTDKGFOTACSHZ-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid |
| InChIKey | YCTDKGFOTACSHZ-UHFFFAOYSA-N |
| SMILES | C1COC2=C(N1)C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)