cas: 90921-09-8 — see every product listed under this CAS number, including other names
3,4-Dihydro-4-oxo-2H-1-benzopyran-7-carboxylic acid, 95%, 95% (CAS 90921-09-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DDVP-100mg |
| cas | 90921-09-8 |
| size | 100mg |
| availability | 0.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 395.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-oxo-2,3-dihydrochromene-7-carboxylic acid (CAS 90921-09-8) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: 4-oxo-2,3-dihydrochromene-7-carboxylic acid. InChIKey: UMDDDSGHXQOLKM-UHFFFAOYSA-N.
| Molecular formula | C10H8O4 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 4-oxo-2,3-dihydrochromene-7-carboxylic acid |
| InChIKey | UMDDDSGHXQOLKM-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1=O)C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)