3,4-Dimethoxybenzamide, 98%
cas: 1521-41-1 — see every product listed under this CAS number, including other names
3,4-Dimethoxybenzamide, 98% (CAS 1521-41-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A431215-250mg |
| cas | 1521-41-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 375.94 Pln | |
| Ambeed | 5g | 1210.31 Pln | |
| Ambeed | 10g | 1783.25 Pln | |
| BLDpharm | 100mg | 181.07 Pln | |
| BLDpharm | 250mg | 231.05 Pln | |
| BLDpharm | 1g | 403.22 Pln | |
| BLDpharm | 5g | 1302.90 Pln | |
| Fluorochem | 100mg | 227.02 Pln | |
| Fluorochem | 250mg | 305.12 Pln | |
| Fluorochem | 1g | 617.51 Pln | |
| Fluorochem | 5g | 1742.11 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
3,4-dimethoxybenzamide (CAS 1521-41-1) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 3,4-dimethoxybenzamide. InChIKey: XNDZRGTVUVVHQT-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 3,4-dimethoxybenzamide |
| InChIKey | XNDZRGTVUVVHQT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)N)OC |
Computed by PubChem (NCBI)