CAS 1521-41-1 appears in our catalog under these names: 3,4-Dimethoxybenzamide, 95%, 3,4–Dimethoxybenzamide, 3,4-Dimethoxybenzamide, Veratramide, 3,4-Dimethoxybenzamide 98%. Offered by: Combi-blocks, GLPBio, TargetMol, Biosynth, Ambeed. Available pack sizes: 250mg, 1g, 50mg, 100mg, 2g, 5g, 10g, Get quote.
3,4-dimethoxybenzamide (CAS 1521-41-1) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 3,4-dimethoxybenzamide. InChIKey: XNDZRGTVUVVHQT-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 3,4-dimethoxybenzamide |
| InChIKey | XNDZRGTVUVVHQT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)N)OC |
Computed by PubChem (NCBI)