cas: 195189-45-8 — see every product listed under this CAS number, including other names
3,5-Bis(4-aminophenoxy)benzoic Acid (CAS 195189-45-8) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114IJR-200mg |
| cas | 195189-45-8 |
| size | 200mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 200mg | 299.60 Pln | |
| Chemat | 1g | 563.60 Pln | |
| Chemat | 5g | 2445.20 Pln |
| delivery time | 3 weeks |
|---|
3,5-bis(4-aminophenoxy)benzoic acid (CAS 195189-45-8) is a chemical compound with the molecular formula C19H16N2O4 and a molecular weight of 336.3 g/mol. IUPAC name: 3,5-bis(4-aminophenoxy)benzoic acid. InChIKey: KPKOSOUTWDOOIW-UHFFFAOYSA-N.
| Molecular formula | C19H16N2O4 |
|---|---|
| Molecular weight | 336.3 g/mol |
| IUPAC name | 3,5-bis(4-aminophenoxy)benzoic acid |
| InChIKey | KPKOSOUTWDOOIW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)OC2=CC(=CC(=C2)C(=O)O)OC3=CC=C(C=C3)N |
Computed by PubChem (NCBI)