cas: 195189-45-8 — see every product listed under this CAS number, including other names
3,5-Bis(4-aminophenoxy)benzoic acid, 96% (CAS 195189-45-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 250mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A540946-5g |
| cas | 195189-45-8 |
| size | 5g |
| availability | Global Stock: 1g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 1775.62 Pln | |
| Fluorochem | 1g | 799.74 Pln | |
| Fluorochem | 250mg | 331.15 Pln |
| purity | 96% |
|---|---|
| delivery time | To be confirmed by Chemat |
3,5-bis(4-aminophenoxy)benzoic acid (CAS 195189-45-8) is a chemical compound with the molecular formula C19H16N2O4 and a molecular weight of 336.3 g/mol. IUPAC name: 3,5-bis(4-aminophenoxy)benzoic acid. InChIKey: KPKOSOUTWDOOIW-UHFFFAOYSA-N.
| Molecular formula | C19H16N2O4 |
|---|---|
| Molecular weight | 336.3 g/mol |
| IUPAC name | 3,5-bis(4-aminophenoxy)benzoic acid |
| InChIKey | KPKOSOUTWDOOIW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)OC2=CC(=CC(=C2)C(=O)O)OC3=CC=C(C=C3)N |
Computed by PubChem (NCBI)