cas: 1451390-93-4 — see every product listed under this CAS number, including other names
3,5-DIFLUORO-4-ISOPROPOXYPHENYLBORONIC ACID (CAS 1451390-93-4) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F467256-5G |
| cas | 1451390-93-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1664.02 Pln |
| delivery time | 3-4 weeks |
|---|
(3,5-difluoro-4-propan-2-yloxyphenyl)boronic acid (CAS 1451390-93-4) is a chemical compound with the molecular formula C9H11BF2O3 and a molecular weight of 215.99 g/mol. IUPAC name: (3,5-difluoro-4-propan-2-yloxyphenyl)boronic acid. InChIKey: SHSBRMCUHPYPIR-UHFFFAOYSA-N.
| Molecular formula | C9H11BF2O3 |
|---|---|
| Molecular weight | 215.99 g/mol |
| IUPAC name | (3,5-difluoro-4-propan-2-yloxyphenyl)boronic acid |
| InChIKey | SHSBRMCUHPYPIR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)OC(C)C)F)(O)O |
Computed by PubChem (NCBI)