cas: 167631-51-8 — see every product listed under this CAS number, including other names
3,5-Dichloro-1h-indole-2-carboxylic acid, 95% (CAS 167631-51-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g. Offered by: Combi-blocks, AmBeed, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | JK-2117-5g |
| cas | 167631-51-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 100mg | price on request | |
| Combi-blocks | 1g | price on request | |
| AmBeed | 10g | 10564.12 Pln | |
| AmBeed | 5g | 7139.86 Pln | |
| Fluorochem | 100mg | 596.68 Pln | |
| Fluorochem | 250mg | 810.15 Pln | |
| Fluorochem | 1g | 1570.30 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
3,5-dichloro-1H-indole-2-carboxylic acid (CAS 167631-51-8) is a chemical compound with the molecular formula C9H5Cl2NO2 and a molecular weight of 230.04 g/mol. IUPAC name: 3,5-dichloro-1H-indole-2-carboxylic acid. InChIKey: ZCIAFCCXZJTKSS-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NO2 |
|---|---|
| Molecular weight | 230.04 g/mol |
| IUPAC name | 3,5-dichloro-1H-indole-2-carboxylic acid |
| InChIKey | ZCIAFCCXZJTKSS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=C(N2)C(=O)O)Cl |
Computed by PubChem (NCBI)