CAS 288401-44-5 is the registry number for 4,6-Dichloro-2-(5-isoxazolyl)phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g.
2,4-dichloro-6-(1,2-oxazol-5-yl)phenol (CAS 288401-44-5) is a chemical compound with the molecular formula C9H5Cl2NO2 and a molecular weight of 230.04 g/mol. IUPAC name: 2,4-dichloro-6-(1,2-oxazol-5-yl)phenol. InChIKey: NWTXPEMLVWSELN-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NO2 |
|---|---|
| Molecular weight | 230.04 g/mol |
| IUPAC name | 2,4-dichloro-6-(1,2-oxazol-5-yl)phenol |
| InChIKey | NWTXPEMLVWSELN-UHFFFAOYSA-N |
| SMILES | C1=C(ON=C1)C2=C(C(=CC(=C2)Cl)Cl)O |
Computed by PubChem (NCBI)