Products 198273-13-1
CAS 198273-13-1 appears in our catalog under these names: Methyl 3-cyano-2,4-dichlorobenzoate, 95%, Methyl 3-cyano-2,4-dichlorobenzoate. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
Methyl 2,4-dichloro-3-cyanobenzoate (CAS 198273-13-1) is a chemical compound with the molecular formula C9H5Cl2NO2 and a molecular weight of 230.04 g/mol. IUPAC name: methyl 2,4-dichloro-3-cyanobenzoate. InChIKey: JITBLAYTOQLGNF-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NO2 |
|---|---|
| Molecular weight | 230.04 g/mol |
| IUPAC name | methyl 2,4-dichloro-3-cyanobenzoate |
| InChIKey | JITBLAYTOQLGNF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)Cl)C#N)Cl |
Computed by PubChem (NCBI)