CAS 1228009-24-2 is the registry number for 6,8-Dichloro-3-hydroxyquinolin-2(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,8-dichloro-3-hydroxy-1H-quinolin-2-one (CAS 1228009-24-2) is a chemical compound with the molecular formula C9H5Cl2NO2 and a molecular weight of 230.04 g/mol. IUPAC name: 6,8-dichloro-3-hydroxy-1H-quinolin-2-one. InChIKey: BRWASOZNABEKNB-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NO2 |
|---|---|
| Molecular weight | 230.04 g/mol |
| IUPAC name | 6,8-dichloro-3-hydroxy-1H-quinolin-2-one |
| InChIKey | BRWASOZNABEKNB-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(C(=O)NC2=C(C=C1Cl)Cl)O |
Computed by PubChem (NCBI)