CAS 106009-19-2 is the registry number for 5,7-Dichloro-1-methyl-1h-indole-2,3-dione, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
5,7-dichloro-1-methylindole-2,3-dione (CAS 106009-19-2) is a chemical compound with the molecular formula C9H5Cl2NO2 and a molecular weight of 230.04 g/mol. IUPAC name: 5,7-dichloro-1-methylindole-2,3-dione. InChIKey: ICPLFAXXZDVXCN-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NO2 |
|---|---|
| Molecular weight | 230.04 g/mol |
| IUPAC name | 5,7-dichloro-1-methylindole-2,3-dione |
| InChIKey | ICPLFAXXZDVXCN-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2Cl)Cl)C(=O)C1=O |
Computed by PubChem (NCBI)