CAS 383132-13-6 appears in our catalog under these names: 6,7-Dichloro-1h-indole-2-carboxylic acid, 96%, 6,7-Dichloro-1H-indole-2-carboxylic acid 98%, 6,7-DICHLORO-1H-INDOLE-2-CARBOXYLIC ACID, 98%, 98%, 6,7-Dichloro-1H-indole-2-carboxylic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 100mg.
6,7-dichloro-1H-indole-2-carboxylic acid (CAS 383132-13-6) is a chemical compound with the molecular formula C9H5Cl2NO2 and a molecular weight of 230.04 g/mol. IUPAC name: 6,7-dichloro-1H-indole-2-carboxylic acid. InChIKey: TUXCSCQQWQOWDU-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NO2 |
|---|---|
| Molecular weight | 230.04 g/mol |
| IUPAC name | 6,7-dichloro-1H-indole-2-carboxylic acid |
| InChIKey | TUXCSCQQWQOWDU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C=C(N2)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)