CAS 96129-74-7 appears in our catalog under these names: 4,7-Dichloro-1h-indole-2-carboxylic acid, 96%, 4,7-Dichloro-1H-indole-2-carboxylic acid, 98%, 4,7-Dichloro-1H-indole-2-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 0,5g.
4,7-dichloro-1H-indole-2-carboxylic acid (CAS 96129-74-7) is a chemical compound with the molecular formula C9H5Cl2NO2 and a molecular weight of 230.04 g/mol. IUPAC name: 4,7-dichloro-1H-indole-2-carboxylic acid. InChIKey: LMYQVAQDBJJBEM-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NO2 |
|---|---|
| Molecular weight | 230.04 g/mol |
| IUPAC name | 4,7-dichloro-1H-indole-2-carboxylic acid |
| InChIKey | LMYQVAQDBJJBEM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1Cl)C=C(N2)C(=O)O)Cl |
Computed by PubChem (NCBI)