Products 4792-71-6
CAS 4792-71-6 appears in our catalog under these names: 5,7-Dichloro-1H-indole-2-carboxylic acid, 95-<97%, 5,7-Dichloro-1H-indole-2-carboxylic acid, ≥97-<99%, 5，7–Dichloro–1H–indole–2–carboxylic acid, 5,7-Dichloro-1H-indole-2-carboxylic acid 97%, 5,7-Dichloro-1H-indole-2-carboxylic acid, 97%, 97%. Offered by: Hoffman Fine Chemicals, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g, 1g, 5g.
5,7-dichloro-1H-indole-2-carboxylic acid (CAS 4792-71-6) is a chemical compound with the molecular formula C9H5Cl2NO2 and a molecular weight of 230.04 g/mol. IUPAC name: 5,7-dichloro-1H-indole-2-carboxylic acid. InChIKey: QILAXMNESNFYJG-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NO2 |
|---|---|
| Molecular weight | 230.04 g/mol |
| IUPAC name | 5,7-dichloro-1H-indole-2-carboxylic acid |
| InChIKey | QILAXMNESNFYJG-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(NC2=C(C=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)