3,5-Dichloro-2-methoxybenzoic acid, 98%
cas: 22775-37-7 — see every product listed under this CAS number, including other names
3,5-Dichloro-2-methoxybenzoic acid, 98% (CAS 22775-37-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F338328-250MG |
| cas | 22775-37-7 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 341.56 Pln | |
| Fluorochem | 5g | 1164.19 Pln | |
| Fluorochem | 10g | 2106.57 Pln | |
| Fluorochem | 25g | 5079.48 Pln | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 342.56 Pln | |
| Ambeed | 5g | 1021.19 Pln | |
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 266.00 Pln | |
| Chemat | 5g | 722.00 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
3,5-dichloro-2-methoxybenzoic acid (CAS 22775-37-7) is a chemical compound with the molecular formula C8H6Cl2O3 and a molecular weight of 221.03 g/mol. IUPAC name: 3,5-dichloro-2-methoxybenzoic acid. InChIKey: AUVSCSCAPKFMEK-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O3 |
|---|---|
| Molecular weight | 221.03 g/mol |
| IUPAC name | 3,5-dichloro-2-methoxybenzoic acid |
| InChIKey | AUVSCSCAPKFMEK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)