3,5-Dichloro-N-methylbenzylamine hydrochloride, 97%
cas: 90389-22-3 — see every product listed under this CAS number, including other names
3,5-Dichloro-N-methylbenzylamine hydrochloride, 97% (CAS 90389-22-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A217155-100mg |
| cas | 90389-22-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 537.25 Pln | |
| Ambeed | 250mg | 770.88 Pln | |
| Ambeed | 1g | 1594.12 Pln | |
| Ambeed | 5g | 4625.69 Pln | |
| BLDpharm | 100mg | 569.82 Pln | |
| BLDpharm | 250mg | 825.29 Pln | |
| BLDpharm | 1g | 1713.87 Pln | |
| BLDpharm | 5g | 4984.94 Pln | |
| Chemat | 100mg | 400.40 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 1000.40 Pln | |
| Chemat | 5g | 3371.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
1-(3,5-dichlorophenyl)-N-methylmethanamine;hydrochloride (CAS 90389-22-3) is a chemical compound with the molecular formula C8H10Cl3N and a molecular weight of 226.5 g/mol. IUPAC name: 1-(3,5-dichlorophenyl)-N-methylmethanamine;hydrochloride. InChIKey: YMCOTVZJEIJWKV-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl3N |
|---|---|
| Molecular weight | 226.5 g/mol |
| IUPAC name | 1-(3,5-dichlorophenyl)-N-methylmethanamine;hydrochloride |
| InChIKey | YMCOTVZJEIJWKV-UHFFFAOYSA-N |
| SMILES | CNCC1=CC(=CC(=C1)Cl)Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
Benzenemethanamine, 3,5-dichloro-N-methyl-, hydrochloride, 3,5-Dichloro-N-methylbenzylamine hydrochloride, 3,5-Dichloro-N-methylbenzylamine HCl, 1-(3,5-dichlorophenyl)-N-methylmethanamine;hydrochloride, 3,5-Dichloro-N-methylbenzylamineHydrochloride, 1-(3,5-dichlorophenyl)-N-methylmethanamine hydrochloride, 3,5-Dichloro-N-methylbenzenemethanamine hydrochloride, N-Methyl-3,5-dichlorobenzylamine hydrochloride, YMCOTVZJEIJWKV-UHFFFAOYSA-N, 3,5-dichlorobenzyl-methylamine hydrochloride
