CAS 90389-22-3 appears in our catalog under these names: 3,5-Dichloro-n-methylbenzylamine hydrochloride, 95%, 3,5–Dichloro–N–methylbenzylamine hydrochloride, 3,5-Dichloro-N-methylbenzylamine Hydrochloride, 97%, 97%, 3,5-Dichloro-N-methylbenzylamine hydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
1-(3,5-dichlorophenyl)-N-methylmethanamine;hydrochloride (CAS 90389-22-3) is a chemical compound with the molecular formula C8H10Cl3N and a molecular weight of 226.5 g/mol. IUPAC name: 1-(3,5-dichlorophenyl)-N-methylmethanamine;hydrochloride. InChIKey: YMCOTVZJEIJWKV-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl3N |
|---|---|
| Molecular weight | 226.5 g/mol |
| IUPAC name | 1-(3,5-dichlorophenyl)-N-methylmethanamine;hydrochloride |
| InChIKey | YMCOTVZJEIJWKV-UHFFFAOYSA-N |
| SMILES | CNCC1=CC(=CC(=C1)Cl)Cl.Cl |
Computed by PubChem (NCBI)