cas: 22821-89-2 — see every product listed under this CAS number, including other names
3,5-Dichlorophenyl Methyl Sulphone 98% (CAS 22821-89-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A956814-250mg |
| cas | 22821-89-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 776.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A956814 |
1,3-dichloro-5-methylsulfonylbenzene (CAS 22821-89-2) is a chemical compound with the molecular formula C7H6Cl2O2S and a molecular weight of 225.09 g/mol. IUPAC name: 1,3-dichloro-5-methylsulfonylbenzene. InChIKey: QIYHQTUAQZMJGS-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2O2S |
|---|---|
| Molecular weight | 225.09 g/mol |
| IUPAC name | 1,3-dichloro-5-methylsulfonylbenzene |
| InChIKey | QIYHQTUAQZMJGS-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)