cas: 22821-89-2 — see every product listed under this CAS number, including other names
3,5-Dichlorophenylmethylsulfone (CAS 22821-89-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F019371-1G |
| cas | 22821-89-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 450.90 Pln | |
| Fluorochem | 5g | 1346.42 Pln | |
| Fluorochem | 25g | 4413.05 Pln |
| delivery time | 3-4 weeks |
|---|
1,3-dichloro-5-methylsulfonylbenzene (CAS 22821-89-2) is a chemical compound with the molecular formula C7H6Cl2O2S and a molecular weight of 225.09 g/mol. IUPAC name: 1,3-dichloro-5-methylsulfonylbenzene. InChIKey: QIYHQTUAQZMJGS-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2O2S |
|---|---|
| Molecular weight | 225.09 g/mol |
| IUPAC name | 1,3-dichloro-5-methylsulfonylbenzene |
| InChIKey | QIYHQTUAQZMJGS-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)