cas: 147808-41-1 — see every product listed under this CAS number, including other names
3,5-Difluoro-4-nitrophenol 95% (CAS 147808-41-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A282009-100mg |
| cas | 147808-41-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 431.56 Pln | |
| Ambeed | 250mg | 720.81 Pln | |
| Ambeed | 1g | 1749.88 Pln | |
| Ambeed | 5g | 5120.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A282009 |
3,5-difluoro-4-nitrophenol (CAS 147808-41-1) is a chemical compound with the molecular formula C6H3F2NO3 and a molecular weight of 175.09 g/mol. IUPAC name: 3,5-difluoro-4-nitrophenol. InChIKey: DDNBXAHODWXJKM-UHFFFAOYSA-N.
| Molecular formula | C6H3F2NO3 |
|---|---|
| Molecular weight | 175.09 g/mol |
| IUPAC name | 3,5-difluoro-4-nitrophenol |
| InChIKey | DDNBXAHODWXJKM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)[N+](=O)[O-])F)O |
Computed by PubChem (NCBI)