cas: 147808-41-1 — see every product listed under this CAS number, including other names
3,5-Difluoro-4-nitrophenol, 95%, 95% (CAS 147808-41-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112F8U-100mg |
| cas | 147808-41-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 328.40 Pln | |
| Chemat | 250mg | 539.60 Pln | |
| Chemat | 1g | 1298.00 Pln | |
| Chemat | 5g | 3765.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3,5-difluoro-4-nitrophenol (CAS 147808-41-1) is a chemical compound with the molecular formula C6H3F2NO3 and a molecular weight of 175.09 g/mol. IUPAC name: 3,5-difluoro-4-nitrophenol. InChIKey: DDNBXAHODWXJKM-UHFFFAOYSA-N.
| Molecular formula | C6H3F2NO3 |
|---|---|
| Molecular weight | 175.09 g/mol |
| IUPAC name | 3,5-difluoro-4-nitrophenol |
| InChIKey | DDNBXAHODWXJKM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)[N+](=O)[O-])F)O |
Computed by PubChem (NCBI)