cas: 147808-41-1 — see every product listed under this CAS number, including other names
3,5-Difluoro-4-nitrophenol, 98% (CAS 147808-41-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F334453-100MG |
| cas | 147808-41-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 529.00 Pln | |
| Fluorochem | 250mg | 810.15 Pln | |
| Fluorochem | 1g | 2007.64 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3,5-difluoro-4-nitrophenol (CAS 147808-41-1) is a chemical compound with the molecular formula C6H3F2NO3 and a molecular weight of 175.09 g/mol. IUPAC name: 3,5-difluoro-4-nitrophenol. InChIKey: DDNBXAHODWXJKM-UHFFFAOYSA-N.
| Molecular formula | C6H3F2NO3 |
|---|---|
| Molecular weight | 175.09 g/mol |
| IUPAC name | 3,5-difluoro-4-nitrophenol |
| InChIKey | DDNBXAHODWXJKM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)[N+](=O)[O-])F)O |
Computed by PubChem (NCBI)