3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-methylbutanoic acid, 97%, 97%
cas: 244031-65-0 — see every product listed under this CAS number, including other names
3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-methylbutanoic acid, 97%, 97% (CAS 244031-65-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I5P7-100mg |
| cas | 244031-65-0 |
| size | 100mg |
| availability | 30g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 237.20 Pln | |
| Chemat | 250mg | 357.20 Pln | |
| Chemat | 1g | 947.60 Pln | |
| Chemat | 5g | 3016.40 Pln | |
| Chemat | 10g | 4787.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoic acid (CAS 244031-65-0) is a chemical compound with the molecular formula C20H21NO4 and a molecular weight of 339.4 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoic acid. InChIKey: PLCQKKONXZEZCF-UHFFFAOYSA-N.
| Molecular formula | C20H21NO4 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoic acid |
| InChIKey | PLCQKKONXZEZCF-UHFFFAOYSA-N |
| SMILES | CC(C)(CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)
Synonyms:
3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-methylbutanoic acid, 3-({[(9h-fluoren-9-yl)methoxy]carbonyl}amino)-3-methylbutanoic acid, Fmoc-3-amino-3-methyl-butyric acid, n-fmoc-3-amino-3-methylbutanoic acid, 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoic acid, Fmoc-3-amino-3-methylbutyric acid, Fmoc-3-amino-3-methyl-butyricacid, 3-(Fmoc-amino)-3-methylbutanoic Acid, 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methyl-butanoic acid