CAS 400779-65-9 appears in our catalog under these names: Fmoc-n-me-aib-oh, 95%, 2–((((9H–Fluoren–9–yl)methoxy)carbonyl)(methyl)amino)–2–methylpropanoic acid, Fmoc-N-Me-Aib-OH, FMOC-N-ME-AIB-OH, >=96.0%, FMOC-N-ME-AIB-OH, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Sigma-Aldrich, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg, 2,5g, 25g, 10g.
2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-2-methylpropanoic acid (CAS 400779-65-9) is a chemical compound with the molecular formula C20H21NO4 and a molecular weight of 339.4 g/mol. IUPAC name: 2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-2-methylpropanoic acid. InChIKey: HFPNKXXPYGPHJQ-UHFFFAOYSA-N.
| Molecular formula | C20H21NO4 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-2-methylpropanoic acid |
| InChIKey | HFPNKXXPYGPHJQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)