cas: 1379811-81-0 — see every product listed under this CAS number, including other names
3-(((Benzyloxy)carbonyl)amino)oxetane-3-carboxylic acid 95% (CAS 1379811-81-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A311050-100mg |
| cas | 1379811-81-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 570.62 Pln | |
| Ambeed | 250mg | 715.25 Pln | |
| Ambeed | 1g | 1366.06 Pln | |
| Ambeed | 5g | 5343.25 Pln | |
| Ambeed | 10g | 7963.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A311050 |
3-(phenylmethoxycarbonylamino)oxetane-3-carboxylic acid (CAS 1379811-81-0) is a chemical compound with the molecular formula C12H13NO5 and a molecular weight of 251.23 g/mol. IUPAC name: 3-(phenylmethoxycarbonylamino)oxetane-3-carboxylic acid. InChIKey: SDACJLQSZZYSTE-UHFFFAOYSA-N.
| Molecular formula | C12H13NO5 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | 3-(phenylmethoxycarbonylamino)oxetane-3-carboxylic acid |
| InChIKey | SDACJLQSZZYSTE-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)