CAS 1018143-27-5 appears in our catalog under these names: 3-(2,5-Dimethoxyphenyl)-4,5-dihydroisoxazole-5-carboxylic acid, 95%, 3-(2,5-Dimethoxyphenyl)-4,5-dihydroisoxazole-5-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
3-(2,5-dimethoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid (CAS 1018143-27-5) is a chemical compound with the molecular formula C12H13NO5 and a molecular weight of 251.23 g/mol. IUPAC name: 3-(2,5-dimethoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid. InChIKey: TVKIPMFFMHSWBP-UHFFFAOYSA-N.
| Molecular formula | C12H13NO5 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | 3-(2,5-dimethoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid |
| InChIKey | TVKIPMFFMHSWBP-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)C2=NOC(C2)C(=O)O |
Computed by PubChem (NCBI)