cas: 13058-13-4 — see every product listed under this CAS number, including other names
3-(2,3,4-Trihydroxyphenyl)acrylic acid, 97+% (CAS 13058-13-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A639483-5g |
| cas | 13058-13-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 11918.20 Pln | |
| AmBeed | 10g | 14405.02 Pln | |
| AmBeed | 100mg | 779.59 Pln |
| purity | 97+% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2E)-3-(2,3,4-trihydroxyphenyl)prop-2-enoic acid is a hydroxycinnamic acid.
Source: ChEBI
| Molecular formula | C9H8O5 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | (E)-3-(2,3,4-trihydroxyphenyl)prop-2-enoic acid |
| InChIKey | RHGWNBSOWGUGPA-DUXPYHPUSA-N |
| SMILES | C1=CC(=C(C(=C1/C=C/C(=O)O)O)O)O |
Computed by PubChem (NCBI)