cas: 124937-73-1 — see every product listed under this CAS number, including other names
3-(2-Methoxy-5-methyl-phenyl)-3-phenyl-propan-1-ol, 98% (CAS 124937-73-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F036591-250MG |
| cas | 124937-73-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 440.49 Pln | |
| Fluorochem | 5g | 1205.84 Pln | |
| Fluorochem | 25g | 3356.13 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-(2-methoxy-5-methylphenyl)-3-phenylpropan-1-ol (CAS 124937-73-1) is a chemical compound with the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. IUPAC name: 3-(2-methoxy-5-methylphenyl)-3-phenylpropan-1-ol. InChIKey: OCGTUTJXBDQGKL-UHFFFAOYSA-N.
| Molecular formula | C17H20O2 |
|---|---|
| Molecular weight | 256.34 g/mol |
| IUPAC name | 3-(2-methoxy-5-methylphenyl)-3-phenylpropan-1-ol |
| InChIKey | OCGTUTJXBDQGKL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC)C(CCO)C2=CC=CC=C2 |
Computed by PubChem (NCBI)