Products 1350761-63-5
CAS 1350761-63-5 is the registry number for 8-Cyclopropyl-2,2-dimethylspiro[chroman-4,1'-cyclopropane]-6-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-cyclopropyl-2,2-dimethylspiro[3H-chromene-4,1'-cyclopropane]-6-carbaldehyde (CAS 1350761-63-5) is a chemical compound with the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. IUPAC name: 8-cyclopropyl-2,2-dimethylspiro[3H-chromene-4,1'-cyclopropane]-6-carbaldehyde. InChIKey: ZOBNEOZRDGHHTP-UHFFFAOYSA-N.
| Molecular formula | C17H20O2 |
|---|---|
| Molecular weight | 256.34 g/mol |
| IUPAC name | 8-cyclopropyl-2,2-dimethylspiro[3H-chromene-4,1'-cyclopropane]-6-carbaldehyde |
| InChIKey | ZOBNEOZRDGHHTP-UHFFFAOYSA-N |
| SMILES | CC1(CC2(CC2)C3=CC(=CC(=C3O1)C4CC4)C=O)C |
Computed by PubChem (NCBI)