CAS 1233342-41-0 is the registry number for 1,3-Dimethoxy-4-(1-methyl-1-phenylethyl)benzene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
2,4-dimethoxy-1-(2-phenylpropan-2-yl)benzene (CAS 1233342-41-0) is a chemical compound with the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. IUPAC name: 2,4-dimethoxy-1-(2-phenylpropan-2-yl)benzene. InChIKey: GOSCUKUJMWIQNP-UHFFFAOYSA-N.
| Molecular formula | C17H20O2 |
|---|---|
| Molecular weight | 256.34 g/mol |
| IUPAC name | 2,4-dimethoxy-1-(2-phenylpropan-2-yl)benzene |
| InChIKey | GOSCUKUJMWIQNP-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CC=C1)C2=C(C=C(C=C2)OC)OC |
Computed by PubChem (NCBI)