cas: 284492-15-5 — see every product listed under this CAS number, including other names
3-(3-Chloro-phenyl)-3-(9 H -fluoren-9-ylmethoxycarbonylamino)-propionic acid, 97% (CAS 284492-15-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F028286-1G |
| cas | 284492-15-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1403.69 Pln | |
| Fluorochem | 500mg | 950.72 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-(3-chlorophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 284492-15-5) is a chemical compound with the molecular formula C24H20ClNO4 and a molecular weight of 421.9 g/mol. IUPAC name: 3-(3-chlorophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: UTITXXQGMMKCQD-UHFFFAOYSA-N.
| Molecular formula | C24H20ClNO4 |
|---|---|
| Molecular weight | 421.9 g/mol |
| IUPAC name | 3-(3-chlorophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | UTITXXQGMMKCQD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC(=O)O)C4=CC(=CC=C4)Cl |
Computed by PubChem (NCBI)