cas: 486422-08-6 — see every product listed under this CAS number, including other names
3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide, 95% (CAS 486422-08-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F447477-250MG |
| cas | 486422-08-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 143.72 Pln | |
| Fluorochem | 1g | 247.85 Pln | |
| Fluorochem | 5g | 945.52 Pln | |
| Fluorochem | 10g | 1830.62 Pln | |
| Fluorochem | 25g | 4480.73 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide (CAS 486422-08-6) is a chemical compound with the molecular formula C12H18BNO4S and a molecular weight of 283.16 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide. InChIKey: OHKKUZJVWWPUNY-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO4S |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
| InChIKey | OHKKUZJVWWPUNY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)S(=O)(=O)N |
Computed by PubChem (NCBI)