cas: 486422-08-6 — see every product listed under this CAS number, including other names
Benzenesulfonamide, 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, 95%, 95% (CAS 486422-08-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I9SO-100mg |
| cas | 486422-08-6 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 218.00 Pln | |
| Chemat | 5g | 726.80 Pln | |
| Chemat | 25g | 3376.40 Pln | |
| Chemat | 10g | 1389.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide (CAS 486422-08-6) is a chemical compound with the molecular formula C12H18BNO4S and a molecular weight of 283.16 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide. InChIKey: OHKKUZJVWWPUNY-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO4S |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
| InChIKey | OHKKUZJVWWPUNY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)S(=O)(=O)N |
Computed by PubChem (NCBI)