cas: 7761-30-0 — see every product listed under this CAS number, including other names
3-(4-Fluorophenyl)-2-oxopropanoic acid, 97% (CAS 7761-30-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A781027-100mg |
| cas | 7761-30-0 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 538.72 Pln | |
| AmBeed | 5g | 7387.24 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-(4-fluorophenyl)-3-oxopropanoic acid (CAS 7761-30-0) is a chemical compound with the molecular formula C9H7FO3 and a molecular weight of 182.15 g/mol. IUPAC name: 3-(4-fluorophenyl)-3-oxopropanoic acid. InChIKey: WSWKUJUQMXOEQK-UHFFFAOYSA-N.
| Molecular formula | C9H7FO3 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-3-oxopropanoic acid |
| InChIKey | WSWKUJUQMXOEQK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CC(=O)O)F |
Computed by PubChem (NCBI)