cas: 7761-30-0 — see every product listed under this CAS number, including other names
3-(4-fluorophenyl)-2-hydroxyprop-2-enoic acid, 97% (CAS 7761-30-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F640625-50MG |
| cas | 7761-30-0 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 268.67 Pln | |
| Fluorochem | 100mg | 346.77 Pln | |
| Fluorochem | 250mg | 560.24 Pln | |
| Fluorochem | 500mg | 987.17 Pln | |
| Fluorochem | 1g | 1393.28 Pln | |
| Fluorochem | 2.5g | 3402.99 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-(4-fluorophenyl)-3-oxopropanoic acid (CAS 7761-30-0) is a chemical compound with the molecular formula C9H7FO3 and a molecular weight of 182.15 g/mol. IUPAC name: 3-(4-fluorophenyl)-3-oxopropanoic acid. InChIKey: WSWKUJUQMXOEQK-UHFFFAOYSA-N.
| Molecular formula | C9H7FO3 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-3-oxopropanoic acid |
| InChIKey | WSWKUJUQMXOEQK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CC(=O)O)F |
Computed by PubChem (NCBI)