cas: 61266-32-8 — see every product listed under this CAS number, including other names
3-(4-Nitrophenyl)prop-2-yn-1-ol, 97% (CAS 61266-32-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 500mg, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A768262-10g |
| cas | 61266-32-8 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 20381.20 Pln | |
| Fluorochem | 500mg | 1403.69 Pln | |
| Fluorochem | 1g | 2059.71 Pln | |
| Fluorochem | 5g | 6683.08 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-(4-nitrophenyl)prop-2-yn-1-ol (CAS 61266-32-8) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 3-(4-nitrophenyl)prop-2-yn-1-ol. InChIKey: IVTAMNNBGCKOBI-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 3-(4-nitrophenyl)prop-2-yn-1-ol |
| InChIKey | IVTAMNNBGCKOBI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#CCO)[N+](=O)[O-] |
Computed by PubChem (NCBI)