cas: 1119452-71-9 — see every product listed under this CAS number, including other names
3-(5-(Chloromethyl)-1,2,4-oxadiazol-3-yl)benzoyl chloride, 97% (CAS 1119452-71-9) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A533138-5g |
| cas | 1119452-71-9 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 10225.60 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]benzoyl chloride (CAS 1119452-71-9) is a chemical compound with the molecular formula C10H6Cl2N2O2 and a molecular weight of 257.07 g/mol. IUPAC name: 3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]benzoyl chloride. InChIKey: HJRGPUANWLVKTD-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2O2 |
|---|---|
| Molecular weight | 257.07 g/mol |
| IUPAC name | 3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]benzoyl chloride |
| InChIKey | HJRGPUANWLVKTD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)Cl)C2=NOC(=N2)CCl |
Computed by PubChem (NCBI)