CAS 115316-10-4 appears in our catalog under these names: 1-(2,4-Dichlorophenyl)-1H-pyrazole-3-carboxylic acid, 95%, 1-(2,4-Dichlorophenyl)-1H-pyrazole-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1-(2,4-dichlorophenyl)pyrazole-3-carboxylic acid (CAS 115316-10-4) is a chemical compound with the molecular formula C10H6Cl2N2O2 and a molecular weight of 257.07 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)pyrazole-3-carboxylic acid. InChIKey: VBPQJKXKGFYNQD-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2O2 |
|---|---|
| Molecular weight | 257.07 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)pyrazole-3-carboxylic acid |
| InChIKey | VBPQJKXKGFYNQD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)N2C=CC(=N2)C(=O)O |
Computed by PubChem (NCBI)